1-(4-Aminophenyl)-4-(4-hydroxyphenyl)piperazine
Current rating is 0.00. Total votes 0.
| CAS NO.: |
74853-08-0 |
Catalog: |
PIP038 |
| Formula: |
C16H19N3O |
Purity: |
98.00% + |
| Molecular Weight: |
269.34 |
Pubchem CID: |
10221065 |
| InChI Key: |
WZIJMPVPOMTRNM-UHFFFAOYSA-N |
| Canonical SMILES: |
C1CN(CCN1C2=CC=C(C=C2)N)C3=CC=C(C=C3)O |
| Storage: |
Store in a cool, dry and well-ventilated area away from incompatible substances. |
USD $0.00