2-Benzyl-4,5-dichloropyridazin-3(2H)-one
Current rating is 0.00. Total votes 0.
| CAS NO.: |
41933-33-9 |
Catalog: |
PYR0210 |
| Formula: |
C11H8Cl2N2O |
Purity: |
97.00% + |
| Molecular Weight: |
255.1 |
Pubchem CID: |
722438 |
| InChI Key: |
AJHBQZQCDCTOFD-UHFFFAOYSA-N |
| Canonical SMILES: |
C1=CC=C(C=C1)CN2C(=O)C(=C(C=N2)Cl)Cl |
| Storage: |
Store in a cool, dry and well-ventilated area away from incompatible substances. |
USD $0.00