2-bromo-11H-benzo[a]carbazole
Current rating is 0.00. Total votes 0.
| CAS NO.: |
103569-04-6 |
Catalog: |
ACJ056 |
| Formula: |
C16H10BrN |
Purity: |
98.00% + |
| Molecular Weight: |
296.16 |
Pubchem CID: |
126718678 |
| InChI Key: |
VVAYDCCJEGELFR-UHFFFAOYSA-N |
| Canonical SMILES: |
C1=CC=C2C(=C1)C3=C(N2)C4=C(C=CC(=C4)Br)C=C3 |
| Storage: |
Store in a cool, dry and well-ventilated area away from incompatible substances. |
USD $0.00