2-(Methoxycarbonyl)isonicotinic acid
Current rating is 0.00. Total votes 0.
| CAS NO.: |
24195-10-6 |
Catalog: |
PRD3942 |
| Formula: |
C8H7NO4 |
Purity: |
97.00% + |
| Molecular Weight: |
181.15 |
Pubchem CID: |
18753310 |
| InChI Key: |
MAFJOMAYYKSZOS-UHFFFAOYSA-N |
| Canonical SMILES: |
COC(=O)C1=NC=CC(=C1)C(=O)O |
| Storage: |
Store in a cool, dry and well-ventilated area away from incompatible substances. |
USD $0.00