9-(8-bromooctyl)carbazole
Current rating is 0.00. Total votes 0.
| CAS NO.: |
127271-60-7 |
Catalog: |
AC0455 |
| Formula: |
C20H24BrN |
Purity: |
98.00% + |
| Molecular Weight: |
358.3 |
Pubchem CID: |
71340521 |
| InChI Key: |
DNLQXAKEJJPELB-UHFFFAOYSA-N |
| Canonical SMILES: |
C1=CC=C2C(=C1)C3=CC=CC=C3N2CCCCCCCCBr |
| Storage: |
Store in a cool, dry and well-ventilated area away from incompatible substances. |
USD $0.00