9H-Carbazole, 9-octyl-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-
Current rating is 0.00. Total votes 0.
| CAS NO.: |
793681-93-3 |
Catalog: |
JY021 |
| Formula: |
C26H36BNO2 |
Purity: |
99.00% + |
| Molecular Weight: |
405.4 |
Pubchem CID: |
102310355 |
| InChI Key: |
ALUCVCBSXNYMAM-UHFFFAOYSA-N |
| Canonical SMILES: |
B1(OC(C(O1)(C)C)(C)C)C2=CC3=C(C=C2)C4=CC=CC=C4N3CCCCCCCC |
| Storage: |
Store in a cool, dry and well-ventilated area away from incompatible substances. |
USD $0.00