"3,6-dibromo-9-{4-[(2-ethylhexyl)oxy]phenyl}-9H-carbazole"
Current rating is 0.00. Total votes 0.
| CAS NO.: |
946491-48-1 |
Catalog: |
AC0445 |
| Formula: |
C26H27Br2NO |
Purity: |
98.00% + |
| Molecular Weight: |
529.3 |
Pubchem CID: |
68106047 |
| InChI Key: |
ACUVALSRGHGNLZ-UHFFFAOYSA-N |
| Canonical SMILES: |
CCCCC(CC)COC1=CC=C(C=C1)N2C3=C(C=C(C=C3)Br)C4=C2C=CC(=C4)Br |
| Storage: |
Store in a cool, dry and well-ventilated area away from incompatible substances. |
USD $0.00